[(1S,2R,4S,7R,9R,10R,11S,12R)-4,10-dihydroxy-2-(hydroxymethyl)-1,5-dimethylspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-11-yl] acetate
(Q104969639)
chemical compound
chemical compound
Language:
Current Data About
[(1S,2R,4S,7R,9R,10R,11S,12R)-4,10-dihydroxy-2-(hydroxymethyl)-1,5-dimethylspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-11-yl] acetate
| (P31) |
(Q113145171)
|
||||
| (P233) |
O=C(OC1C(O)C2OC3C=C(C)C(O)CC3(CO)C1(C)C42OC4)C
|
||||
| (P274) |
C₁₇H₂₄O₇
|
||||
| (P279) |
(Q108266224)
|
||||
| (P703) |
(Q5114748)
(Q3091099)
|
||||
| (P2017) |
CC(=O)O[C@@H]1[C@@H](O)[C@H]2O[C@@H]3C=C(C)[C@@H](O)C[C@]3(CO)[C@]1(C)[C@@]21CO1
|
||||
| (P2067) |
340.152203108
|
other details